C10H14FNO4S — CID 168593347
3-(2-fluoro-5-methylsulfonylanilino)propane-1,2-diol (PubChem CID 168593347) has the molecular formula C10H14FNO4S and a molecular weight of 263.29 g/mol. Its IUPAC name is 3-(2-fluoro-5-methylsulfonylanilino)propane-1,2-diol.
| Compound Name | 3-(2-fluoro-5-methylsulfonylanilino)propane-1,2-diol |
|---|---|
| PubChem CID | 168593347 |
| Molecular Formula | C10H14FNO4S |
| Molecular Weight | 263.29 g/mol |
| Exact Mass | 263.06 |
| IUPAC Name | 3-(2-fluoro-5-methylsulfonylanilino)propane-1,2-diol |
| SMILES | CS(=O)(=O)c1ccc(F)c(NCC(O)CO)c1 |
| InChI | InChI=1S/C10H14FNO4S/c1-17(15,16)8-2-3-9(11)10(4-8)12-5-7(14)6-13/h2-4,7,12-14H,5-6H2,1H3 |
| InChIKey | SSWPTFMFHBRCLL-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.29 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |