C20H25ClN2O5S2 — CID 55752915
N-[2-chloro-5-(diethylsulfamoyl)phenyl]-4-propan-2-ylsulfonylbenzamide (PubChem CID 55752915) has the molecular formula C20H25ClN2O5S2 and a molecular weight of 473.02 g/mol. Its IUPAC name is N-[2-chloro-5-(diethylsulfamoyl)phenyl]-4-propan-2-ylsulfonylbenzamide.
| Compound Name | N-[2-chloro-5-(diethylsulfamoyl)phenyl]-4-propan-2-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 55752915 |
| Molecular Formula | C20H25ClN2O5S2 |
| Molecular Weight | 473.02 g/mol |
| Exact Mass | 472.09 |
| IUPAC Name | N-[2-chloro-5-(diethylsulfamoyl)phenyl]-4-propan-2-ylsulfonylbenzamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(Cl)c(NC(=O)c2ccc(S(=O)(=O)C(C)C)cc2)c1 |
| InChI | InChI=1S/C20H25ClN2O5S2/c1-5-23(6-2)30(27,28)17-11-12-18(21)19(13-17)22-20(24)15-7-9-16(10-8-15)29(25,26)14(3)4/h7-14H,5-6H2,1-4H3,(H,22,24) |
| InChIKey | HUWBLUGSQFXCPJ-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.02 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |