C18H23N3O3S — CID 28867137
N-(5-amino-2-methylphenyl)-4-(diethylsulfamoyl)benzamide (PubChem CID 28867137) has the molecular formula C18H23N3O3S and a molecular weight of 361.47 g/mol. Its IUPAC name is N-(5-amino-2-methylphenyl)-4-(diethylsulfamoyl)benzamide.
| Compound Name | N-(5-amino-2-methylphenyl)-4-(diethylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 28867137 |
| Molecular Formula | C18H23N3O3S |
| Molecular Weight | 361.47 g/mol |
| Exact Mass | 361.15 |
| IUPAC Name | N-(5-amino-2-methylphenyl)-4-(diethylsulfamoyl)benzamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(C(=O)Nc2cc(N)ccc2C)cc1 |
| InChI | InChI=1S/C18H23N3O3S/c1-4-21(5-2)25(23,24)16-10-7-14(8-11-16)18(22)20-17-12-15(19)9-6-13(17)3/h6-12H,4-5,19H2,1-3H3,(H,20,22) |
| InChIKey | QIFJKECWNNPVCB-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.47 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|