C19H23ClN2O3S — CID 120568913
N-(5-amino-2-methylphenyl)-4-cyclopentylsulfonylbenzamide;hydrochloride (PubChem CID 120568913) has the molecular formula C19H23ClN2O3S and a molecular weight of 394.92 g/mol. Its IUPAC name is N-(5-amino-2-methylphenyl)-4-cyclopentylsulfonylbenzamide;hydrochloride.
| Compound Name | N-(5-amino-2-methylphenyl)-4-cyclopentylsulfonylbenzamide;hydrochloride |
|---|---|
| PubChem CID | 120568913 |
| Molecular Formula | C19H23ClN2O3S |
| Molecular Weight | 394.92 g/mol |
| Exact Mass | 394.11 |
| IUPAC Name | N-(5-amino-2-methylphenyl)-4-cyclopentylsulfonylbenzamide;hydrochloride |
| SMILES | Cc1ccc(N)cc1NC(=O)c1ccc(S(=O)(=O)C2CCCC2)cc1.Cl |
| InChI | InChI=1S/C19H22N2O3S.ClH/c1-13-6-9-15(20)12-18(13)21-19(22)14-7-10-17(11-8-14)25(23,24)16-4-2-3-5-16;/h6-12,16H,2-5,20H2,1H3,(H,21,22);1H |
| InChIKey | CQXUHOFKBXCATC-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.92 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|