C24H30ClN3O6S — CID 4148507
[2-[2-chloro-5-(diethylsulfamoyl)anilino]-2-oxoethyl] 2-benzamido-3-methylbutanoate (PubChem CID 4148507) has the molecular formula C24H30ClN3O6S and a molecular weight of 524.04 g/mol. Its IUPAC name is [2-[2-chloro-5-(diethylsulfamoyl)anilino]-2-oxoethyl] 2-benzamido-3-methylbutanoate.
| Compound Name | [2-[2-chloro-5-(diethylsulfamoyl)anilino]-2-oxoethyl] 2-benzamido-3-methylbutanoate |
|---|---|
| PubChem CID | 4148507 |
| Molecular Formula | C24H30ClN3O6S |
| Molecular Weight | 524.04 g/mol |
| Exact Mass | 523.15 |
| IUPAC Name | [2-[2-chloro-5-(diethylsulfamoyl)anilino]-2-oxoethyl] 2-benzamido-3-methylbutanoate |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(Cl)c(NC(=O)COC(=O)C(NC(=O)c2ccccc2)C(C)C)c1 |
| InChI | InChI=1S/C24H30ClN3O6S/c1-5-28(6-2)35(32,33)18-12-13-19(25)20(14-18)26-21(29)15-34-24(31)22(16(3)4)27-23(30)17-10-8-7-9-11-17/h7-14,16,22H,5-6,15H2,1-4H3,(H,26,29)(H,27,30) |
| InChIKey | GBQFWNDWDRNLBD-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.04 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |