C10H10ClIN2O2 — CID 168597486
3-chloro-4-(2,3-dihydroxypropylamino)-5-iodobenzonitrile (PubChem CID 168597486) has the molecular formula C10H10ClIN2O2 and a molecular weight of 352.56 g/mol. Its IUPAC name is 3-chloro-4-(2,3-dihydroxypropylamino)-5-iodobenzonitrile.
| Compound Name | 3-chloro-4-(2,3-dihydroxypropylamino)-5-iodobenzonitrile |
|---|---|
| PubChem CID | 168597486 |
| Molecular Formula | C10H10ClIN2O2 |
| Molecular Weight | 352.56 g/mol |
| Exact Mass | 351.95 |
| IUPAC Name | 3-chloro-4-(2,3-dihydroxypropylamino)-5-iodobenzonitrile |
| SMILES | N#Cc1cc(Cl)c(NCC(O)CO)c(I)c1 |
| InChI | InChI=1S/C10H10ClIN2O2/c11-8-1-6(3-13)2-9(12)10(8)14-4-7(16)5-15/h1-2,7,14-16H,4-5H2 |
| InChIKey | IKZXASKMOMNYQN-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 76.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.56 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|