C9H11F2NO3 — CID 168594723
3-(2,6-difluoro-4-hydroxyanilino)propane-1,2-diol (PubChem CID 168594723) has the molecular formula C9H11F2NO3 and a molecular weight of 219.19 g/mol. Its IUPAC name is 3-(2,6-difluoro-4-hydroxyanilino)propane-1,2-diol.
| Compound Name | 3-(2,6-difluoro-4-hydroxyanilino)propane-1,2-diol |
|---|---|
| PubChem CID | 168594723 |
| Molecular Formula | C9H11F2NO3 |
| Molecular Weight | 219.19 g/mol |
| Exact Mass | 219.07 |
| IUPAC Name | 3-(2,6-difluoro-4-hydroxyanilino)propane-1,2-diol |
| SMILES | OCC(O)CNc1c(F)cc(O)cc1F |
| InChI | InChI=1S/C9H11F2NO3/c10-7-1-5(14)2-8(11)9(7)12-3-6(15)4-13/h1-2,6,12-15H,3-4H2 |
| InChIKey | BZPXCRBABGJWKG-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 72.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.19 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|