C10H5Cl2N3O — CID 168524089
2-cyano-N-(2,6-dichloro-4-cyanophenyl)acetamide (PubChem CID 168524089) has the molecular formula C10H5Cl2N3O and a molecular weight of 254.08 g/mol. Its IUPAC name is 2-cyano-N-(2,6-dichloro-4-cyanophenyl)acetamide.
| Compound Name | 2-cyano-N-(2,6-dichloro-4-cyanophenyl)acetamide |
|---|---|
| PubChem CID | 168524089 |
| Molecular Formula | C10H5Cl2N3O |
| Molecular Weight | 254.08 g/mol |
| Exact Mass | 252.98 |
| IUPAC Name | 2-cyano-N-(2,6-dichloro-4-cyanophenyl)acetamide |
| SMILES | N#CCC(=O)Nc1c(Cl)cc(C#N)cc1Cl |
| InChI | InChI=1S/C10H5Cl2N3O/c11-7-3-6(5-14)4-8(12)10(7)15-9(16)1-2-13/h3-4H,1H2,(H,15,16) |
| InChIKey | BQBVQRLNOKWVRA-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 76.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.08 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |