C10H4Cl3F3N2OS — CID 168522275
2-cyano-N-[2,3,6-trichloro-4-(trifluoromethylsulfanyl)phenyl]acetamide (PubChem CID 168522275) has the molecular formula C10H4Cl3F3N2OS and a molecular weight of 363.58 g/mol. Its IUPAC name is 2-cyano-N-[2,3,6-trichloro-4-(trifluoromethylsulfanyl)phenyl]acetamide.
| Compound Name | 2-cyano-N-[2,3,6-trichloro-4-(trifluoromethylsulfanyl)phenyl]acetamide |
|---|---|
| PubChem CID | 168522275 |
| Molecular Formula | C10H4Cl3F3N2OS |
| Molecular Weight | 363.58 g/mol |
| Exact Mass | 361.91 |
| IUPAC Name | 2-cyano-N-[2,3,6-trichloro-4-(trifluoromethylsulfanyl)phenyl]acetamide |
| SMILES | N#CCC(=O)Nc1c(Cl)cc(SC(F)(F)F)c(Cl)c1Cl |
| InChI | InChI=1S/C10H4Cl3F3N2OS/c11-4-3-5(20-10(14,15)16)7(12)8(13)9(4)18-6(19)1-2-17/h3H,1H2,(H,18,19) |
| InChIKey | SXBYPOYVVVLNML-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.58 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|