About N-[2,3,6-trichloro-4-(trifluoromethylsulfanyl)phenyl]formamide
N-[2,3,6-trichloro-4-(trifluoromethylsulfanyl)phenyl]formamide (PubChem CID 168653250) has the molecular formula C8H3Cl3F3NOS
and a molecular weight of 324.54 g/mol. Its IUPAC name is N-[2,3,6-trichloro-4-(trifluoromethylsulfanyl)phenyl]formamide.
Molecular Properties
| Compound Name | N-[2,3,6-trichloro-4-(trifluoromethylsulfanyl)phenyl]formamide |
| PubChem CID | 168653250 |
| Molecular Formula | C8H3Cl3F3NOS |
| Molecular Weight | 324.54 g/mol |
| Exact Mass | 322.90 |
| IUPAC Name | N-[2,3,6-trichloro-4-(trifluoromethylsulfanyl)phenyl]formamide |
| SMILES | O=CNc1c(Cl)cc(SC(F)(F)F)c(Cl)c1Cl |
| InChI | InChI=1S/C8H3Cl3F3NOS/c9-3-1-4(17-8(12,13)14)5(10)6(11)7(3)15-2-16/h1-2H,(H,15,16) |
| InChIKey | CPQHPPYCHPLIBX-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.54 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze N-[2,3,6-trichloro-4-(trifluoromethylsulfanyl)phenyl]formamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2,3,6-trichloro-4-(trifluoromethylsulfanyl)phenyl]formamide?
The IUPAC name of N-[2,3,6-trichloro-4-(trifluoromethylsulfanyl)phenyl]formamide (CID 168653250) is N-[2,3,6-trichloro-4-(trifluoromethylsulfanyl)phenyl]formamide.
What is the SMILES notation for N-[2,3,6-trichloro-4-(trifluoromethylsulfanyl)phenyl]formamide?
The canonical SMILES for N-[2,3,6-trichloro-4-(trifluoromethylsulfanyl)phenyl]formamide is O=CNc1c(Cl)cc(SC(F)(F)F)c(Cl)c1Cl.
What is the InChIKey of N-[2,3,6-trichloro-4-(trifluoromethylsulfanyl)phenyl]formamide?
The InChIKey is CPQHPPYCHPLIBX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H3Cl3F3NOS/c9-3-1-4(17-8(12,13)14)5(10)6(11)7(3)15-2-16/h1-2H,(H,15,16).
What are the key properties of N-[2,3,6-trichloro-4-(trifluoromethylsulfanyl)phenyl]formamide?
N-[2,3,6-trichloro-4-(trifluoromethylsulfanyl)phenyl]formamide has a molecular weight of 324.54 g/mol, XLogP of 4.83, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2,3,6-trichloro-4-(trifluoromethylsulfanyl)phenyl]formamide is sourced from PubChem (CID 168653250), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).