C8H3Cl3F3NOS — CID 168653250
N-[2,3,6-trichloro-4-(trifluoromethylsulfanyl)phenyl]formamide (PubChem CID 168653250) has the molecular formula C8H3Cl3F3NOS and a molecular weight of 324.54 g/mol. Its IUPAC name is N-[2,3,6-trichloro-4-(trifluoromethylsulfanyl)phenyl]formamide.
| Compound Name | N-[2,3,6-trichloro-4-(trifluoromethylsulfanyl)phenyl]formamide |
|---|---|
| PubChem CID | 168653250 |
| Molecular Formula | C8H3Cl3F3NOS |
| Molecular Weight | 324.54 g/mol |
| Exact Mass | 322.90 |
| IUPAC Name | N-[2,3,6-trichloro-4-(trifluoromethylsulfanyl)phenyl]formamide |
| SMILES | O=CNc1c(Cl)cc(SC(F)(F)F)c(Cl)c1Cl |
| InChI | InChI=1S/C8H3Cl3F3NOS/c9-3-1-4(17-8(12,13)14)5(10)6(11)7(3)15-2-16/h1-2H,(H,15,16) |
| InChIKey | CPQHPPYCHPLIBX-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.54 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|