C8H6Cl3NO3S — CID 43135246
3,5-dichloro-4-formamido-2-methylbenzenesulfonyl chloride (PubChem CID 43135246) has the molecular formula C8H6Cl3NO3S and a molecular weight of 302.57 g/mol. Its IUPAC name is 3,5-dichloro-4-formamido-2-methylbenzenesulfonyl chloride.
| Compound Name | 3,5-dichloro-4-formamido-2-methylbenzenesulfonyl chloride |
|---|---|
| PubChem CID | 43135246 |
| Molecular Formula | C8H6Cl3NO3S |
| Molecular Weight | 302.57 g/mol |
| Exact Mass | 300.91 |
| IUPAC Name | 3,5-dichloro-4-formamido-2-methylbenzenesulfonyl chloride |
| SMILES | Cc1c(S(=O)(=O)Cl)cc(Cl)c(NC=O)c1Cl |
| InChI | InChI=1S/C8H6Cl3NO3S/c1-4-6(16(11,14)15)2-5(9)8(7(4)10)12-3-13/h2-3H,1H3,(H,12,13) |
| InChIKey | XNHOAMRVTPANBU-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.57 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|