C12H16Cl2N2O3S — CID 43246587
N-(2,6-dichloro-3-methyl-4-sulfamoylphenyl)pentanamide (PubChem CID 43246587) has the molecular formula C12H16Cl2N2O3S and a molecular weight of 339.24 g/mol. Its IUPAC name is N-(2,6-dichloro-3-methyl-4-sulfamoylphenyl)pentanamide.
| Compound Name | N-(2,6-dichloro-3-methyl-4-sulfamoylphenyl)pentanamide |
|---|---|
| PubChem CID | 43246587 |
| Molecular Formula | C12H16Cl2N2O3S |
| Molecular Weight | 339.24 g/mol |
| Exact Mass | 338.03 |
| IUPAC Name | N-(2,6-dichloro-3-methyl-4-sulfamoylphenyl)pentanamide |
| SMILES | CCCCC(=O)Nc1c(Cl)cc(S(N)(=O)=O)c(C)c1Cl |
| InChI | InChI=1S/C12H16Cl2N2O3S/c1-3-4-5-10(17)16-12-8(13)6-9(20(15,18)19)7(2)11(12)14/h6H,3-5H2,1-2H3,(H,16,17)(H2,15,18,19) |
| InChIKey | YXFYTPDVRYXHLA-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.24 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |