C10H8Cl2N4O3S2 — CID 65216272
N-(2,6-dichloro-3-methyl-4-sulfamoylphenyl)thiadiazole-4-carboxamide (PubChem CID 65216272) has the molecular formula C10H8Cl2N4O3S2 and a molecular weight of 367.24 g/mol. Its IUPAC name is N-(2,6-dichloro-3-methyl-4-sulfamoylphenyl)thiadiazole-4-carboxamide.
| Compound Name | N-(2,6-dichloro-3-methyl-4-sulfamoylphenyl)thiadiazole-4-carboxamide |
|---|---|
| PubChem CID | 65216272 |
| Molecular Formula | C10H8Cl2N4O3S2 |
| Molecular Weight | 367.24 g/mol |
| Exact Mass | 365.94 |
| IUPAC Name | N-(2,6-dichloro-3-methyl-4-sulfamoylphenyl)thiadiazole-4-carboxamide |
| SMILES | Cc1c(S(N)(=O)=O)cc(Cl)c(NC(=O)c2csnn2)c1Cl |
| InChI | InChI=1S/C10H8Cl2N4O3S2/c1-4-7(21(13,18)19)2-5(11)9(8(4)12)14-10(17)6-3-20-16-15-6/h2-3H,1H3,(H,14,17)(H2,13,18,19) |
| InChIKey | KMCWVYKSRDONQJ-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 115.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.24 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |