C8H8Cl2N2O3S — CID 154352075
N-(4,5-dichloro-2-sulfamoylphenyl)acetamide (PubChem CID 154352075) has the molecular formula C8H8Cl2N2O3S and a molecular weight of 283.14 g/mol. Its IUPAC name is N-(4,5-dichloro-2-sulfamoylphenyl)acetamide.
| Compound Name | N-(4,5-dichloro-2-sulfamoylphenyl)acetamide |
|---|---|
| PubChem CID | 154352075 |
| Molecular Formula | C8H8Cl2N2O3S |
| Molecular Weight | 283.14 g/mol |
| Exact Mass | 281.96 |
| IUPAC Name | N-(4,5-dichloro-2-sulfamoylphenyl)acetamide |
| SMILES | CC(=O)Nc1cc(Cl)c(Cl)cc1S(N)(=O)=O |
| InChI | InChI=1S/C8H8Cl2N2O3S/c1-4(13)12-7-2-5(9)6(10)3-8(7)16(11,14)15/h2-3H,1H3,(H,12,13)(H2,11,14,15) |
| InChIKey | IPCRDNBOTWDBMQ-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.14 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |