C7H7Cl2NO2S — CID 104727916
2,5-dichloro-4-methylbenzenesulfonamide (PubChem CID 104727916) has the molecular formula C7H7Cl2NO2S and a molecular weight of 240.11 g/mol. Its IUPAC name is 2,5-dichloro-4-methylbenzenesulfonamide.
| Compound Name | 2,5-dichloro-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 104727916 |
| Molecular Formula | C7H7Cl2NO2S |
| Molecular Weight | 240.11 g/mol |
| Exact Mass | 238.96 |
| IUPAC Name | 2,5-dichloro-4-methylbenzenesulfonamide |
| SMILES | Cc1cc(Cl)c(S(N)(=O)=O)cc1Cl |
| InChI | InChI=1S/C7H7Cl2NO2S/c1-4-2-6(9)7(3-5(4)8)13(10,11)12/h2-3H,1H3,(H2,10,11,12) |
| InChIKey | VRTZTDLUGCPZBU-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.11 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |