C7H9ClN2O4S2 — CID 134098209
4-chloro-5-methylbenzene-1,3-disulfonamide (PubChem CID 134098209) has the molecular formula C7H9ClN2O4S2 and a molecular weight of 284.75 g/mol. Its IUPAC name is 4-chloro-5-methylbenzene-1,3-disulfonamide.
| Compound Name | 4-chloro-5-methylbenzene-1,3-disulfonamide |
|---|---|
| PubChem CID | 134098209 |
| Molecular Formula | C7H9ClN2O4S2 |
| Molecular Weight | 284.75 g/mol |
| Exact Mass | 283.97 |
| IUPAC Name | 4-chloro-5-methylbenzene-1,3-disulfonamide |
| SMILES | Cc1cc(S(N)(=O)=O)cc(S(N)(=O)=O)c1Cl |
| InChI | InChI=1S/C7H9ClN2O4S2/c1-4-2-5(15(9,11)12)3-6(7(4)8)16(10,13)14/h2-3H,1H3,(H2,9,11,12)(H2,10,13,14) |
| InChIKey | YASAESZJWJWWII-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 120.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.75 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |