C6H5Cl2KN2O4S2 — CID 161295210
potassium (3,4-dichloro-5-sulfamoylphenyl)sulfonylazanide (PubChem CID 161295210) has the molecular formula C6H5Cl2KN2O4S2 and a molecular weight of 343.25 g/mol. Its IUPAC name is potassium (3,4-dichloro-5-sulfamoylphenyl)sulfonylazanide.
| Compound Name | potassium (3,4-dichloro-5-sulfamoylphenyl)sulfonylazanide |
|---|---|
| PubChem CID | 161295210 |
| Molecular Formula | C6H5Cl2KN2O4S2 |
| Molecular Weight | 343.25 g/mol |
| Exact Mass | 341.87 |
| IUPAC Name | potassium (3,4-dichloro-5-sulfamoylphenyl)sulfonylazanide |
| SMILES | [K+].[NH-]S(=O)(=O)c1cc(Cl)c(Cl)c(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C6H5Cl2N2O4S2.K/c7-4-1-3(15(9,11)12)2-5(6(4)8)16(10,13)14;/h1-2H,(H3-,9,10,11,12,13,14);/q-1;+1 |
| InChIKey | VGWNXOHDZWABAG-UHFFFAOYSA-N |
| XLogP | -1.61 |
| TPSA | 118.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.25 |
| LogP ≤ 5 | -1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |