potassium (3,4-dichloro-5-sulfamoylphenyl)sulfonylazanide

C6H5Cl2KN2O4S2 — CID 161295210

IUPACpotassium (3,4-dichloro-5-sulfamoylphenyl)sulfonylazanide
SMILES[K+].[NH-]S(=O)(=O)c1cc(Cl)c(Cl)c(S(N)(=O)=O)c1
InChIInChI=1S/C6H5Cl2N2O4S2.K/c7-4-1-3(15(9,11)12)2-5(6(4)8)16(10,13)14;/h1-2H,(H3-,9,10,11,12,13,14);/q-1;+1
InChIKeyVGWNXOHDZWABAG-UHFFFAOYSA-N
MW343.25 g/mol
LogP-1.61
Rot. Bonds2

About potassium (3,4-dichloro-5-sulfamoylphenyl)sulfonylazanide

potassium (3,4-dichloro-5-sulfamoylphenyl)sulfonylazanide (PubChem CID 161295210) has the molecular formula C6H5Cl2KN2O4S2 and a molecular weight of 343.25 g/mol. Its IUPAC name is potassium (3,4-dichloro-5-sulfamoylphenyl)sulfonylazanide.

Molecular Properties

Compound Namepotassium (3,4-dichloro-5-sulfamoylphenyl)sulfonylazanide
PubChem CID161295210
Molecular FormulaC6H5Cl2KN2O4S2
Molecular Weight343.25 g/mol
Exact Mass341.87
IUPAC Namepotassium (3,4-dichloro-5-sulfamoylphenyl)sulfonylazanide
SMILES[K+].[NH-]S(=O)(=O)c1cc(Cl)c(Cl)c(S(N)(=O)=O)c1
InChIInChI=1S/C6H5Cl2N2O4S2.K/c7-4-1-3(15(9,11)12)2-5(6(4)8)16(10,13)14;/h1-2H,(H3-,9,10,11,12,13,14);/q-1;+1
InChIKeyVGWNXOHDZWABAG-UHFFFAOYSA-N
XLogP-1.61
TPSA118.10 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500343.25
LogP ≤ 5-1.61
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze potassium (3,4-dichloro-5-sulfamoylphenyl)sulfonylazanide with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of potassium (3,4-dichloro-5-sulfamoylphenyl)sulfonylazanide?
The IUPAC name of potassium (3,4-dichloro-5-sulfamoylphenyl)sulfonylazanide (CID 161295210) is potassium (3,4-dichloro-5-sulfamoylphenyl)sulfonylazanide.
What is the SMILES notation for potassium (3,4-dichloro-5-sulfamoylphenyl)sulfonylazanide?
The canonical SMILES for potassium (3,4-dichloro-5-sulfamoylphenyl)sulfonylazanide is [K+].[NH-]S(=O)(=O)c1cc(Cl)c(Cl)c(S(N)(=O)=O)c1.
What is the InChIKey of potassium (3,4-dichloro-5-sulfamoylphenyl)sulfonylazanide?
The InChIKey is VGWNXOHDZWABAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5Cl2N2O4S2.K/c7-4-1-3(15(9,11)12)2-5(6(4)8)16(10,13)14;/h1-2H,(H3-,9,10,11,12,13,14);/q-1;+1.
What are the key properties of potassium (3,4-dichloro-5-sulfamoylphenyl)sulfonylazanide?
potassium (3,4-dichloro-5-sulfamoylphenyl)sulfonylazanide has a molecular weight of 343.25 g/mol, XLogP of -1.61, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for potassium (3,4-dichloro-5-sulfamoylphenyl)sulfonylazanide is sourced from PubChem (CID 161295210), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).