C13H15Cl2NO3S — CID 114190036
3,5-dichloro-4-(4,4-dimethylpent-2-ynoxy)benzenesulfonamide (PubChem CID 114190036) has the molecular formula C13H15Cl2NO3S and a molecular weight of 336.24 g/mol. Its IUPAC name is 3,5-dichloro-4-(4,4-dimethylpent-2-ynoxy)benzenesulfonamide.
| Compound Name | 3,5-dichloro-4-(4,4-dimethylpent-2-ynoxy)benzenesulfonamide |
|---|---|
| PubChem CID | 114190036 |
| Molecular Formula | C13H15Cl2NO3S |
| Molecular Weight | 336.24 g/mol |
| Exact Mass | 335.01 |
| IUPAC Name | 3,5-dichloro-4-(4,4-dimethylpent-2-ynoxy)benzenesulfonamide |
| SMILES | CC(C)(C)C#CCOc1c(Cl)cc(S(N)(=O)=O)cc1Cl |
| InChI | InChI=1S/C13H15Cl2NO3S/c1-13(2,3)5-4-6-19-12-10(14)7-9(8-11(12)15)20(16,17)18/h7-8H,6H2,1-3H3,(H2,16,17,18) |
| InChIKey | OZVGDLKEHSBZCI-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.24 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|