C11H12Cl2N2O4S — CID 82914772
N-cyclopropyl-2-(2,6-dichloro-4-sulfamoylphenoxy)acetamide (PubChem CID 82914772) has the molecular formula C11H12Cl2N2O4S and a molecular weight of 339.20 g/mol. Its IUPAC name is N-cyclopropyl-2-(2,6-dichloro-4-sulfamoylphenoxy)acetamide.
| Compound Name | N-cyclopropyl-2-(2,6-dichloro-4-sulfamoylphenoxy)acetamide |
|---|---|
| PubChem CID | 82914772 |
| Molecular Formula | C11H12Cl2N2O4S |
| Molecular Weight | 339.20 g/mol |
| Exact Mass | 337.99 |
| IUPAC Name | N-cyclopropyl-2-(2,6-dichloro-4-sulfamoylphenoxy)acetamide |
| SMILES | NS(=O)(=O)c1cc(Cl)c(OCC(=O)NC2CC2)c(Cl)c1 |
| InChI | InChI=1S/C11H12Cl2N2O4S/c12-8-3-7(20(14,17)18)4-9(13)11(8)19-5-10(16)15-6-1-2-6/h3-4,6H,1-2,5H2,(H,15,16)(H2,14,17,18) |
| InChIKey | IKEXKJCLLFGVJA-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.20 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |