C12H14F2N2O4S — CID 82916178
N-cyclopropyl-3-(2,6-difluoro-4-sulfamoylphenoxy)propanamide (PubChem CID 82916178) has the molecular formula C12H14F2N2O4S and a molecular weight of 320.32 g/mol. Its IUPAC name is N-cyclopropyl-3-(2,6-difluoro-4-sulfamoylphenoxy)propanamide.
| Compound Name | N-cyclopropyl-3-(2,6-difluoro-4-sulfamoylphenoxy)propanamide |
|---|---|
| PubChem CID | 82916178 |
| Molecular Formula | C12H14F2N2O4S |
| Molecular Weight | 320.32 g/mol |
| Exact Mass | 320.06 |
| IUPAC Name | N-cyclopropyl-3-(2,6-difluoro-4-sulfamoylphenoxy)propanamide |
| SMILES | NS(=O)(=O)c1cc(F)c(OCCC(=O)NC2CC2)c(F)c1 |
| InChI | InChI=1S/C12H14F2N2O4S/c13-9-5-8(21(15,18)19)6-10(14)12(9)20-4-3-11(17)16-7-1-2-7/h5-7H,1-4H2,(H,16,17)(H2,15,18,19) |
| InChIKey | SKGHQMKHQUDDBA-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.32 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |