C15H13Cl3N2O4S — CID 35292285
N-[(4-sulfamoylphenyl)methyl]-2-(2,4,6-trichlorophenoxy)acetamide (PubChem CID 35292285) has the molecular formula C15H13Cl3N2O4S and a molecular weight of 423.71 g/mol. Its IUPAC name is N-[(4-sulfamoylphenyl)methyl]-2-(2,4,6-trichlorophenoxy)acetamide.
| Compound Name | N-[(4-sulfamoylphenyl)methyl]-2-(2,4,6-trichlorophenoxy)acetamide |
|---|---|
| PubChem CID | 35292285 |
| Molecular Formula | C15H13Cl3N2O4S |
| Molecular Weight | 423.71 g/mol |
| Exact Mass | 421.97 |
| IUPAC Name | N-[(4-sulfamoylphenyl)methyl]-2-(2,4,6-trichlorophenoxy)acetamide |
| SMILES | NS(=O)(=O)c1ccc(CNC(=O)COc2c(Cl)cc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C15H13Cl3N2O4S/c16-10-5-12(17)15(13(18)6-10)24-8-14(21)20-7-9-1-3-11(4-2-9)25(19,22)23/h1-6H,7-8H2,(H,20,21)(H2,19,22,23) |
| InChIKey | ZTPOYIXIKNRNQD-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.71 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |