C9H7Cl4NO3S — CID 82915373
3,5-dichloro-4-[(Z)-2,3-dichloroprop-2-enoxy]benzenesulfonamide (PubChem CID 82915373) has the molecular formula C9H7Cl4NO3S and a molecular weight of 351.04 g/mol. Its IUPAC name is 3,5-dichloro-4-[(Z)-2,3-dichloroprop-2-enoxy]benzenesulfonamide.
| Compound Name | 3,5-dichloro-4-[(Z)-2,3-dichloroprop-2-enoxy]benzenesulfonamide |
|---|---|
| PubChem CID | 82915373 |
| Molecular Formula | C9H7Cl4NO3S |
| Molecular Weight | 351.04 g/mol |
| Exact Mass | 348.89 |
| IUPAC Name | 3,5-dichloro-4-[(Z)-2,3-dichloroprop-2-enoxy]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1cc(Cl)c(OC/C(Cl)=C/Cl)c(Cl)c1 |
| InChI | InChI=1S/C9H7Cl4NO3S/c10-3-5(11)4-17-9-7(12)1-6(2-8(9)13)18(14,15)16/h1-3H,4H2,(H2,14,15,16)/b5-3- |
| InChIKey | RUSUBXSPLYIPBN-HYXAFXHYSA-N |
| XLogP | 3.34 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.04 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |