C10H13Cl2NO4S — CID 60801262
3,5-dichloro-4-(2-ethoxyethoxy)benzenesulfonamide (PubChem CID 60801262) has the molecular formula C10H13Cl2NO4S and a molecular weight of 314.19 g/mol. Its IUPAC name is 3,5-dichloro-4-(2-ethoxyethoxy)benzenesulfonamide.
| Compound Name | 3,5-dichloro-4-(2-ethoxyethoxy)benzenesulfonamide |
|---|---|
| PubChem CID | 60801262 |
| Molecular Formula | C10H13Cl2NO4S |
| Molecular Weight | 314.19 g/mol |
| Exact Mass | 312.99 |
| IUPAC Name | 3,5-dichloro-4-(2-ethoxyethoxy)benzenesulfonamide |
| SMILES | CCOCCOc1c(Cl)cc(S(N)(=O)=O)cc1Cl |
| InChI | InChI=1S/C10H13Cl2NO4S/c1-2-16-3-4-17-10-8(11)5-7(6-9(10)12)18(13,14)15/h5-6H,2-4H2,1H3,(H2,13,14,15) |
| InChIKey | VJFNTIXMWZKMCL-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.19 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|