C12H17F2NO4S — CID 81267946
4-(2-butoxyethoxy)-3,5-difluorobenzenesulfonamide (PubChem CID 81267946) has the molecular formula C12H17F2NO4S and a molecular weight of 309.33 g/mol. Its IUPAC name is 4-(2-butoxyethoxy)-3,5-difluorobenzenesulfonamide.
| Compound Name | 4-(2-butoxyethoxy)-3,5-difluorobenzenesulfonamide |
|---|---|
| PubChem CID | 81267946 |
| Molecular Formula | C12H17F2NO4S |
| Molecular Weight | 309.33 g/mol |
| Exact Mass | 309.08 |
| IUPAC Name | 4-(2-butoxyethoxy)-3,5-difluorobenzenesulfonamide |
| SMILES | CCCCOCCOc1c(F)cc(S(N)(=O)=O)cc1F |
| InChI | InChI=1S/C12H17F2NO4S/c1-2-3-4-18-5-6-19-12-10(13)7-9(8-11(12)14)20(15,16)17/h7-8H,2-6H2,1H3,(H2,15,16,17) |
| InChIKey | YEOAIOPDVWXILS-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.33 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|