C10H11Cl3O5S2 — CID 61057811
3,5-dichloro-4-(2-ethylsulfonylethoxy)benzenesulfonyl chloride (PubChem CID 61057811) has the molecular formula C10H11Cl3O5S2 and a molecular weight of 381.69 g/mol. Its IUPAC name is 3,5-dichloro-4-(2-ethylsulfonylethoxy)benzenesulfonyl chloride.
| Compound Name | 3,5-dichloro-4-(2-ethylsulfonylethoxy)benzenesulfonyl chloride |
|---|---|
| PubChem CID | 61057811 |
| Molecular Formula | C10H11Cl3O5S2 |
| Molecular Weight | 381.69 g/mol |
| Exact Mass | 379.91 |
| IUPAC Name | 3,5-dichloro-4-(2-ethylsulfonylethoxy)benzenesulfonyl chloride |
| SMILES | CCS(=O)(=O)CCOc1c(Cl)cc(S(=O)(=O)Cl)cc1Cl |
| InChI | InChI=1S/C10H11Cl3O5S2/c1-2-19(14,15)4-3-18-10-8(11)5-7(6-9(10)12)20(13,16)17/h5-6H,2-4H2,1H3 |
| InChIKey | ZUZYWHAUOSACQI-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.69 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |