C11H13Cl3O3S — CID 60800384
3,5-dichloro-4-(3-methylbutoxy)benzenesulfonyl chloride (PubChem CID 60800384) has the molecular formula C11H13Cl3O3S and a molecular weight of 331.65 g/mol. Its IUPAC name is 3,5-dichloro-4-(3-methylbutoxy)benzenesulfonyl chloride.
| Compound Name | 3,5-dichloro-4-(3-methylbutoxy)benzenesulfonyl chloride |
|---|---|
| PubChem CID | 60800384 |
| Molecular Formula | C11H13Cl3O3S |
| Molecular Weight | 331.65 g/mol |
| Exact Mass | 329.97 |
| IUPAC Name | 3,5-dichloro-4-(3-methylbutoxy)benzenesulfonyl chloride |
| SMILES | CC(C)CCOc1c(Cl)cc(S(=O)(=O)Cl)cc1Cl |
| InChI | InChI=1S/C11H13Cl3O3S/c1-7(2)3-4-17-11-9(12)5-8(6-10(11)13)18(14,15)16/h5-7H,3-4H2,1-2H3 |
| InChIKey | GEESJHIVTNHHEE-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.65 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |