C14H21ClO3S — CID 83157191
3,5-dimethyl-2-(4-methylpentoxy)benzenesulfonyl chloride (PubChem CID 83157191) has the molecular formula C14H21ClO3S and a molecular weight of 304.84 g/mol. Its IUPAC name is 3,5-dimethyl-2-(4-methylpentoxy)benzenesulfonyl chloride.
| Compound Name | 3,5-dimethyl-2-(4-methylpentoxy)benzenesulfonyl chloride |
|---|---|
| PubChem CID | 83157191 |
| Molecular Formula | C14H21ClO3S |
| Molecular Weight | 304.84 g/mol |
| Exact Mass | 304.09 |
| IUPAC Name | 3,5-dimethyl-2-(4-methylpentoxy)benzenesulfonyl chloride |
| SMILES | Cc1cc(C)c(OCCCC(C)C)c(S(=O)(=O)Cl)c1 |
| InChI | InChI=1S/C14H21ClO3S/c1-10(2)6-5-7-18-14-12(4)8-11(3)9-13(14)19(15,16)17/h8-10H,5-7H2,1-4H3 |
| InChIKey | LIWCFKOOEPVULY-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.84 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|