C14H23NO3S — CID 83158027
3,5-dimethyl-2-(4-methylpentoxy)benzenesulfonamide (PubChem CID 83158027) has the molecular formula C14H23NO3S and a molecular weight of 285.41 g/mol. Its IUPAC name is 3,5-dimethyl-2-(4-methylpentoxy)benzenesulfonamide.
| Compound Name | 3,5-dimethyl-2-(4-methylpentoxy)benzenesulfonamide |
|---|---|
| PubChem CID | 83158027 |
| Molecular Formula | C14H23NO3S |
| Molecular Weight | 285.41 g/mol |
| Exact Mass | 285.14 |
| IUPAC Name | 3,5-dimethyl-2-(4-methylpentoxy)benzenesulfonamide |
| SMILES | Cc1cc(C)c(OCCCC(C)C)c(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C14H23NO3S/c1-10(2)6-5-7-18-14-12(4)8-11(3)9-13(14)19(15,16)17/h8-10H,5-7H2,1-4H3,(H2,15,16,17) |
| InChIKey | BSGTYSFGDNDILN-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.41 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|