C13H19NO3S — CID 114473034
3,5-dimethyl-2-(3-methylbut-3-enoxy)benzenesulfonamide (PubChem CID 114473034) has the molecular formula C13H19NO3S and a molecular weight of 269.37 g/mol. Its IUPAC name is 3,5-dimethyl-2-(3-methylbut-3-enoxy)benzenesulfonamide.
| Compound Name | 3,5-dimethyl-2-(3-methylbut-3-enoxy)benzenesulfonamide |
|---|---|
| PubChem CID | 114473034 |
| Molecular Formula | C13H19NO3S |
| Molecular Weight | 269.37 g/mol |
| Exact Mass | 269.11 |
| IUPAC Name | 3,5-dimethyl-2-(3-methylbut-3-enoxy)benzenesulfonamide |
| SMILES | C=C(C)CCOc1c(C)cc(C)cc1S(N)(=O)=O |
| InChI | InChI=1S/C13H19NO3S/c1-9(2)5-6-17-13-11(4)7-10(3)8-12(13)18(14,15)16/h7-8H,1,5-6H2,2-4H3,(H2,14,15,16) |
| InChIKey | URVDHGWZQRZOIF-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.37 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|