C11H13Cl2NO3S — CID 82915155
2-[(Z)-2,3-dichloroprop-2-enoxy]-3,5-dimethylbenzenesulfonamide (PubChem CID 82915155) has the molecular formula C11H13Cl2NO3S and a molecular weight of 310.20 g/mol. Its IUPAC name is 2-[(Z)-2,3-dichloroprop-2-enoxy]-3,5-dimethylbenzenesulfonamide.
| Compound Name | 2-[(Z)-2,3-dichloroprop-2-enoxy]-3,5-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 82915155 |
| Molecular Formula | C11H13Cl2NO3S |
| Molecular Weight | 310.20 g/mol |
| Exact Mass | 309.00 |
| IUPAC Name | 2-[(Z)-2,3-dichloroprop-2-enoxy]-3,5-dimethylbenzenesulfonamide |
| SMILES | Cc1cc(C)c(OC/C(Cl)=C/Cl)c(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C11H13Cl2NO3S/c1-7-3-8(2)11(17-6-9(13)5-12)10(4-7)18(14,15)16/h3-5H,6H2,1-2H3,(H2,14,15,16)/b9-5- |
| InChIKey | FZKZCUARIDSOPK-UITAMQMPSA-N |
| XLogP | 2.65 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.20 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |