C13H17N3O4S — CID 82915793
N-(2-cyanoethyl)-2-(2,4-dimethyl-6-sulfamoylphenoxy)acetamide (PubChem CID 82915793) has the molecular formula C13H17N3O4S and a molecular weight of 311.36 g/mol. Its IUPAC name is N-(2-cyanoethyl)-2-(2,4-dimethyl-6-sulfamoylphenoxy)acetamide.
| Compound Name | N-(2-cyanoethyl)-2-(2,4-dimethyl-6-sulfamoylphenoxy)acetamide |
|---|---|
| PubChem CID | 82915793 |
| Molecular Formula | C13H17N3O4S |
| Molecular Weight | 311.36 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | N-(2-cyanoethyl)-2-(2,4-dimethyl-6-sulfamoylphenoxy)acetamide |
| SMILES | Cc1cc(C)c(OCC(=O)NCCC#N)c(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C13H17N3O4S/c1-9-6-10(2)13(11(7-9)21(15,18)19)20-8-12(17)16-5-3-4-14/h6-7H,3,5,8H2,1-2H3,(H,16,17)(H2,15,18,19) |
| InChIKey | UQPKPLUCZQQWGG-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 122.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.36 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|