C14H16N2O4 — CID 28932954
4-[2-(2-cyanoethylamino)-2-oxoethoxy]-3,5-dimethylbenzoic acid (PubChem CID 28932954) has the molecular formula C14H16N2O4 and a molecular weight of 276.29 g/mol. Its IUPAC name is 4-[2-(2-cyanoethylamino)-2-oxoethoxy]-3,5-dimethylbenzoic acid.
| Compound Name | 4-[2-(2-cyanoethylamino)-2-oxoethoxy]-3,5-dimethylbenzoic acid |
|---|---|
| PubChem CID | 28932954 |
| Molecular Formula | C14H16N2O4 |
| Molecular Weight | 276.29 g/mol |
| Exact Mass | 276.11 |
| IUPAC Name | 4-[2-(2-cyanoethylamino)-2-oxoethoxy]-3,5-dimethylbenzoic acid |
| SMILES | Cc1cc(C(=O)O)cc(C)c1OCC(=O)NCCC#N |
| InChI | InChI=1S/C14H16N2O4/c1-9-6-11(14(18)19)7-10(2)13(9)20-8-12(17)16-5-3-4-15/h6-7H,3,5,8H2,1-2H3,(H,16,17)(H,18,19) |
| InChIKey | REGBMMNATZURND-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 99.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.29 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|