C11H11N3O4 — CID 79795043
5-[2-(2-cyanoethylamino)-2-oxoethoxy]pyridine-2-carboxylic acid (PubChem CID 79795043) has the molecular formula C11H11N3O4 and a molecular weight of 249.23 g/mol. Its IUPAC name is 5-[2-(2-cyanoethylamino)-2-oxoethoxy]pyridine-2-carboxylic acid.
| Compound Name | 5-[2-(2-cyanoethylamino)-2-oxoethoxy]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 79795043 |
| Molecular Formula | C11H11N3O4 |
| Molecular Weight | 249.23 g/mol |
| Exact Mass | 249.07 |
| IUPAC Name | 5-[2-(2-cyanoethylamino)-2-oxoethoxy]pyridine-2-carboxylic acid |
| SMILES | N#CCCNC(=O)COc1ccc(C(=O)O)nc1 |
| InChI | InChI=1S/C11H11N3O4/c12-4-1-5-13-10(15)7-18-8-2-3-9(11(16)17)14-6-8/h2-3,6H,1,5,7H2,(H,13,15)(H,16,17) |
| InChIKey | LDNXOJMNBIAOSC-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 112.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.23 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|