C12H17ClO3S — CID 82915232
3,5-dimethyl-2-(2-methylpropoxy)benzenesulfonyl chloride (PubChem CID 82915232) has the molecular formula C12H17ClO3S and a molecular weight of 276.79 g/mol. Its IUPAC name is 3,5-dimethyl-2-(2-methylpropoxy)benzenesulfonyl chloride.
| Compound Name | 3,5-dimethyl-2-(2-methylpropoxy)benzenesulfonyl chloride |
|---|---|
| PubChem CID | 82915232 |
| Molecular Formula | C12H17ClO3S |
| Molecular Weight | 276.79 g/mol |
| Exact Mass | 276.06 |
| IUPAC Name | 3,5-dimethyl-2-(2-methylpropoxy)benzenesulfonyl chloride |
| SMILES | Cc1cc(C)c(OCC(C)C)c(S(=O)(=O)Cl)c1 |
| InChI | InChI=1S/C12H17ClO3S/c1-8(2)7-16-12-10(4)5-9(3)6-11(12)17(13,14)15/h5-6,8H,7H2,1-4H3 |
| InChIKey | CEYUXSLVUUUUSS-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.79 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |