C16H25ClO — CID 83942283
1-(4-chlorobutan-2-yl)-3,5-dimethyl-2-(2-methylpropoxy)benzene (PubChem CID 83942283) has the molecular formula C16H25ClO and a molecular weight of 268.83 g/mol. Its IUPAC name is 1-(4-chlorobutan-2-yl)-3,5-dimethyl-2-(2-methylpropoxy)benzene.
| Compound Name | 1-(4-chlorobutan-2-yl)-3,5-dimethyl-2-(2-methylpropoxy)benzene |
|---|---|
| PubChem CID | 83942283 |
| Molecular Formula | C16H25ClO |
| Molecular Weight | 268.83 g/mol |
| Exact Mass | 268.16 |
| IUPAC Name | 1-(4-chlorobutan-2-yl)-3,5-dimethyl-2-(2-methylpropoxy)benzene |
| SMILES | Cc1cc(C)c(OCC(C)C)c(C(C)CCCl)c1 |
| InChI | InChI=1S/C16H25ClO/c1-11(2)10-18-16-14(5)8-12(3)9-15(16)13(4)6-7-17/h8-9,11,13H,6-7,10H2,1-5H3 |
| InChIKey | VMPDZMVIRZBLSX-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.83 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|