C17H29NO2 — CID 83942386
1-amino-4-[3,5-dimethyl-2-(2-methylpropoxy)phenyl]pentan-2-ol (PubChem CID 83942386) has the molecular formula C17H29NO2 and a molecular weight of 279.42 g/mol. Its IUPAC name is 1-amino-4-[3,5-dimethyl-2-(2-methylpropoxy)phenyl]pentan-2-ol.
| Compound Name | 1-amino-4-[3,5-dimethyl-2-(2-methylpropoxy)phenyl]pentan-2-ol |
|---|---|
| PubChem CID | 83942386 |
| Molecular Formula | C17H29NO2 |
| Molecular Weight | 279.42 g/mol |
| Exact Mass | 279.22 |
| IUPAC Name | 1-amino-4-[3,5-dimethyl-2-(2-methylpropoxy)phenyl]pentan-2-ol |
| SMILES | Cc1cc(C)c(OCC(C)C)c(C(C)CC(O)CN)c1 |
| InChI | InChI=1S/C17H29NO2/c1-11(2)10-20-17-14(5)6-12(3)7-16(17)13(4)8-15(19)9-18/h6-7,11,13,15,19H,8-10,18H2,1-5H3 |
| InChIKey | DCHFSWOMHVVLTL-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.42 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |