C16H28N2O2 — CID 83942307
2,4-diamino-1-[3,5-dimethyl-2-(2-methylpropoxy)phenyl]butan-1-ol (PubChem CID 83942307) has the molecular formula C16H28N2O2 and a molecular weight of 280.41 g/mol. Its IUPAC name is 2,4-diamino-1-[3,5-dimethyl-2-(2-methylpropoxy)phenyl]butan-1-ol.
| Compound Name | 2,4-diamino-1-[3,5-dimethyl-2-(2-methylpropoxy)phenyl]butan-1-ol |
|---|---|
| PubChem CID | 83942307 |
| Molecular Formula | C16H28N2O2 |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 280.22 |
| IUPAC Name | 2,4-diamino-1-[3,5-dimethyl-2-(2-methylpropoxy)phenyl]butan-1-ol |
| SMILES | Cc1cc(C)c(OCC(C)C)c(C(O)C(N)CCN)c1 |
| InChI | InChI=1S/C16H28N2O2/c1-10(2)9-20-16-12(4)7-11(3)8-13(16)15(19)14(18)5-6-17/h7-8,10,14-15,19H,5-6,9,17-18H2,1-4H3 |
| InChIKey | XNQIHIJGKQWMCA-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 81.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |