C18H32N2O2 — CID 83934562
2,4-diamino-1-[3-tert-butyl-4-(2-methylpropoxy)phenyl]butan-1-ol (PubChem CID 83934562) has the molecular formula C18H32N2O2 and a molecular weight of 308.47 g/mol. Its IUPAC name is 2,4-diamino-1-[3-tert-butyl-4-(2-methylpropoxy)phenyl]butan-1-ol.
| Compound Name | 2,4-diamino-1-[3-tert-butyl-4-(2-methylpropoxy)phenyl]butan-1-ol |
|---|---|
| PubChem CID | 83934562 |
| Molecular Formula | C18H32N2O2 |
| Molecular Weight | 308.47 g/mol |
| Exact Mass | 308.25 |
| IUPAC Name | 2,4-diamino-1-[3-tert-butyl-4-(2-methylpropoxy)phenyl]butan-1-ol |
| SMILES | CC(C)COc1ccc(C(O)C(N)CCN)cc1C(C)(C)C |
| InChI | InChI=1S/C18H32N2O2/c1-12(2)11-22-16-7-6-13(10-14(16)18(3,4)5)17(21)15(20)8-9-19/h6-7,10,12,15,17,21H,8-9,11,19-20H2,1-5H3 |
| InChIKey | KBDZHZBPNKECOO-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 81.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.47 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |