C13H22N2O2 — CID 83927786
2,4-diamino-1-(4-methoxy-2,5-dimethylphenyl)butan-1-ol (PubChem CID 83927786) has the molecular formula C13H22N2O2 and a molecular weight of 238.33 g/mol. Its IUPAC name is 2,4-diamino-1-(4-methoxy-2,5-dimethylphenyl)butan-1-ol.
| Compound Name | 2,4-diamino-1-(4-methoxy-2,5-dimethylphenyl)butan-1-ol |
|---|---|
| PubChem CID | 83927786 |
| Molecular Formula | C13H22N2O2 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.17 |
| IUPAC Name | 2,4-diamino-1-(4-methoxy-2,5-dimethylphenyl)butan-1-ol |
| SMILES | COc1cc(C)c(C(O)C(N)CCN)cc1C |
| InChI | InChI=1S/C13H22N2O2/c1-8-7-12(17-3)9(2)6-10(8)13(16)11(15)4-5-14/h6-7,11,13,16H,4-5,14-15H2,1-3H3 |
| InChIKey | ABEHJSBTUMNBHJ-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 81.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |