C20H34O3 — CID 83942398
2-[3,5-dimethyl-2-(2-methylpropoxy)phenyl]octane-4,5-diol (PubChem CID 83942398) has the molecular formula C20H34O3 and a molecular weight of 322.49 g/mol. Its IUPAC name is 2-[3,5-dimethyl-2-(2-methylpropoxy)phenyl]octane-4,5-diol.
| Compound Name | 2-[3,5-dimethyl-2-(2-methylpropoxy)phenyl]octane-4,5-diol |
|---|---|
| PubChem CID | 83942398 |
| Molecular Formula | C20H34O3 |
| Molecular Weight | 322.49 g/mol |
| Exact Mass | 322.25 |
| IUPAC Name | 2-[3,5-dimethyl-2-(2-methylpropoxy)phenyl]octane-4,5-diol |
| SMILES | CCCC(O)C(O)CC(C)c1cc(C)cc(C)c1OCC(C)C |
| InChI | InChI=1S/C20H34O3/c1-7-8-18(21)19(22)11-15(5)17-10-14(4)9-16(6)20(17)23-12-13(2)3/h9-10,13,15,18-19,21-22H,7-8,11-12H2,1-6H3 |
| InChIKey | PMPQXVRSJILASE-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.49 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |