C18H30O3 — CID 83932516
2-[2-(2-methylpropoxy)phenyl]octane-4,5-diol (PubChem CID 83932516) has the molecular formula C18H30O3 and a molecular weight of 294.44 g/mol. Its IUPAC name is 2-[2-(2-methylpropoxy)phenyl]octane-4,5-diol.
| Compound Name | 2-[2-(2-methylpropoxy)phenyl]octane-4,5-diol |
|---|---|
| PubChem CID | 83932516 |
| Molecular Formula | C18H30O3 |
| Molecular Weight | 294.44 g/mol |
| Exact Mass | 294.22 |
| IUPAC Name | 2-[2-(2-methylpropoxy)phenyl]octane-4,5-diol |
| SMILES | CCCC(O)C(O)CC(C)c1ccccc1OCC(C)C |
| InChI | InChI=1S/C18H30O3/c1-5-8-16(19)17(20)11-14(4)15-9-6-7-10-18(15)21-12-13(2)3/h6-7,9-10,13-14,16-17,19-20H,5,8,11-12H2,1-4H3 |
| InChIKey | XDIICGPJAIYJIH-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.44 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |