C10H12Cl2O5S2 — CID 62104796
5-chloro-2-(2-ethylsulfonylethoxy)benzenesulfonyl chloride (PubChem CID 62104796) has the molecular formula C10H12Cl2O5S2 and a molecular weight of 347.24 g/mol. Its IUPAC name is 5-chloro-2-(2-ethylsulfonylethoxy)benzenesulfonyl chloride.
| Compound Name | 5-chloro-2-(2-ethylsulfonylethoxy)benzenesulfonyl chloride |
|---|---|
| PubChem CID | 62104796 |
| Molecular Formula | C10H12Cl2O5S2 |
| Molecular Weight | 347.24 g/mol |
| Exact Mass | 345.95 |
| IUPAC Name | 5-chloro-2-(2-ethylsulfonylethoxy)benzenesulfonyl chloride |
| SMILES | CCS(=O)(=O)CCOc1ccc(Cl)cc1S(=O)(=O)Cl |
| InChI | InChI=1S/C10H12Cl2O5S2/c1-2-18(13,14)6-5-17-9-4-3-8(11)7-10(9)19(12,15)16/h3-4,7H,2,5-6H2,1H3 |
| InChIKey | OTJUCPKMLVAKRS-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.24 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |