C10H12Cl3NO5S2 — CID 63245920
3,5-dichloro-4-(2-ethoxyethylsulfonylamino)benzenesulfonyl chloride (PubChem CID 63245920) has the molecular formula C10H12Cl3NO5S2 and a molecular weight of 396.70 g/mol. Its IUPAC name is 3,5-dichloro-4-(2-ethoxyethylsulfonylamino)benzenesulfonyl chloride.
| Compound Name | 3,5-dichloro-4-(2-ethoxyethylsulfonylamino)benzenesulfonyl chloride |
|---|---|
| PubChem CID | 63245920 |
| Molecular Formula | C10H12Cl3NO5S2 |
| Molecular Weight | 396.70 g/mol |
| Exact Mass | 394.92 |
| IUPAC Name | 3,5-dichloro-4-(2-ethoxyethylsulfonylamino)benzenesulfonyl chloride |
| SMILES | CCOCCS(=O)(=O)Nc1c(Cl)cc(S(=O)(=O)Cl)cc1Cl |
| InChI | InChI=1S/C10H12Cl3NO5S2/c1-2-19-3-4-20(15,16)14-10-8(11)5-7(6-9(10)12)21(13,17)18/h5-6,14H,2-4H2,1H3 |
| InChIKey | RWHZPDWPQXAXEP-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.70 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|