C8H8Cl3NO4S2 — CID 43097505
3,5-dichloro-4-(ethylsulfonylamino)benzenesulfonyl chloride (PubChem CID 43097505) has the molecular formula C8H8Cl3NO4S2 and a molecular weight of 352.65 g/mol. Its IUPAC name is 3,5-dichloro-4-(ethylsulfonylamino)benzenesulfonyl chloride.
| Compound Name | 3,5-dichloro-4-(ethylsulfonylamino)benzenesulfonyl chloride |
|---|---|
| PubChem CID | 43097505 |
| Molecular Formula | C8H8Cl3NO4S2 |
| Molecular Weight | 352.65 g/mol |
| Exact Mass | 350.90 |
| IUPAC Name | 3,5-dichloro-4-(ethylsulfonylamino)benzenesulfonyl chloride |
| SMILES | CCS(=O)(=O)Nc1c(Cl)cc(S(=O)(=O)Cl)cc1Cl |
| InChI | InChI=1S/C8H8Cl3NO4S2/c1-2-17(13,14)12-8-6(9)3-5(4-7(8)10)18(11,15)16/h3-4,12H,2H2,1H3 |
| InChIKey | LTPLHFISCVMLDG-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.65 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |