3,5-dichloro-4-(ethylsulfonylamino)benzenesulfonyl chloride

C8H8Cl3NO4S2 — CID 43097505

IUPAC3,5-dichloro-4-(ethylsulfonylamino)benzenesulfonyl chloride
SMILESCCS(=O)(=O)Nc1c(Cl)cc(S(=O)(=O)Cl)cc1Cl
InChIInChI=1S/C8H8Cl3NO4S2/c1-2-17(13,14)12-8-6(9)3-5(4-7(8)10)18(11,15)16/h3-4,12H,2H2,1H3
InChIKeyLTPLHFISCVMLDG-UHFFFAOYSA-N
MW352.65 g/mol
LogP2.68
Rot. Bonds4

About 3,5-dichloro-4-(ethylsulfonylamino)benzenesulfonyl chloride

3,5-dichloro-4-(ethylsulfonylamino)benzenesulfonyl chloride (PubChem CID 43097505) has the molecular formula C8H8Cl3NO4S2 and a molecular weight of 352.65 g/mol. Its IUPAC name is 3,5-dichloro-4-(ethylsulfonylamino)benzenesulfonyl chloride.

Molecular Properties

Compound Name3,5-dichloro-4-(ethylsulfonylamino)benzenesulfonyl chloride
PubChem CID43097505
Molecular FormulaC8H8Cl3NO4S2
Molecular Weight352.65 g/mol
Exact Mass350.90
IUPAC Name3,5-dichloro-4-(ethylsulfonylamino)benzenesulfonyl chloride
SMILESCCS(=O)(=O)Nc1c(Cl)cc(S(=O)(=O)Cl)cc1Cl
InChIInChI=1S/C8H8Cl3NO4S2/c1-2-17(13,14)12-8-6(9)3-5(4-7(8)10)18(11,15)16/h3-4,12H,2H2,1H3
InChIKeyLTPLHFISCVMLDG-UHFFFAOYSA-N
XLogP2.68
TPSA80.31 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500352.65
LogP ≤ 52.68
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 3,5-dichloro-4-(ethylsulfonylamino)benzenesulfonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3,5-dichloro-4-(ethylsulfonylamino)benzenesulfonyl chloride?
The IUPAC name of 3,5-dichloro-4-(ethylsulfonylamino)benzenesulfonyl chloride (CID 43097505) is 3,5-dichloro-4-(ethylsulfonylamino)benzenesulfonyl chloride.
What is the SMILES notation for 3,5-dichloro-4-(ethylsulfonylamino)benzenesulfonyl chloride?
The canonical SMILES for 3,5-dichloro-4-(ethylsulfonylamino)benzenesulfonyl chloride is CCS(=O)(=O)Nc1c(Cl)cc(S(=O)(=O)Cl)cc1Cl.
What is the InChIKey of 3,5-dichloro-4-(ethylsulfonylamino)benzenesulfonyl chloride?
The InChIKey is LTPLHFISCVMLDG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8Cl3NO4S2/c1-2-17(13,14)12-8-6(9)3-5(4-7(8)10)18(11,15)16/h3-4,12H,2H2,1H3.
What are the key properties of 3,5-dichloro-4-(ethylsulfonylamino)benzenesulfonyl chloride?
3,5-dichloro-4-(ethylsulfonylamino)benzenesulfonyl chloride has a molecular weight of 352.65 g/mol, XLogP of 2.68, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dichloro-4-(ethylsulfonylamino)benzenesulfonyl chloride is sourced from PubChem (CID 43097505), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).