C7H5Br2Cl2NO2S — CID 83084493
1-bromo-N-(4-bromo-2,6-dichlorophenyl)methanesulfonamide (PubChem CID 83084493) has the molecular formula C7H5Br2Cl2NO2S and a molecular weight of 397.90 g/mol. Its IUPAC name is 1-bromo-N-(4-bromo-2,6-dichlorophenyl)methanesulfonamide.
| Compound Name | 1-bromo-N-(4-bromo-2,6-dichlorophenyl)methanesulfonamide |
|---|---|
| PubChem CID | 83084493 |
| Molecular Formula | C7H5Br2Cl2NO2S |
| Molecular Weight | 397.90 g/mol |
| Exact Mass | 394.78 |
| IUPAC Name | 1-bromo-N-(4-bromo-2,6-dichlorophenyl)methanesulfonamide |
| SMILES | O=S(=O)(CBr)Nc1c(Cl)cc(Br)cc1Cl |
| InChI | InChI=1S/C7H5Br2Cl2NO2S/c8-3-15(13,14)12-7-5(10)1-4(9)2-6(7)11/h1-2,12H,3H2 |
| InChIKey | QQUNZPSXIPCWFR-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.90 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|