C12H10BrCl2N3O2S — CID 43455137
N-(4-bromo-2,6-dichlorophenyl)-2-hydrazinylbenzenesulfonamide (PubChem CID 43455137) has the molecular formula C12H10BrCl2N3O2S and a molecular weight of 411.11 g/mol. Its IUPAC name is N-(4-bromo-2,6-dichlorophenyl)-2-hydrazinylbenzenesulfonamide.
| Compound Name | N-(4-bromo-2,6-dichlorophenyl)-2-hydrazinylbenzenesulfonamide |
|---|---|
| PubChem CID | 43455137 |
| Molecular Formula | C12H10BrCl2N3O2S |
| Molecular Weight | 411.11 g/mol |
| Exact Mass | 408.91 |
| IUPAC Name | N-(4-bromo-2,6-dichlorophenyl)-2-hydrazinylbenzenesulfonamide |
| SMILES | NNc1ccccc1S(=O)(=O)Nc1c(Cl)cc(Br)cc1Cl |
| InChI | InChI=1S/C12H10BrCl2N3O2S/c13-7-5-8(14)12(9(15)6-7)18-21(19,20)11-4-2-1-3-10(11)17-16/h1-6,17-18H,16H2 |
| InChIKey | UDHMNUIMXNUFLH-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.11 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|