C12H11Br2N3O2S — CID 107600992
N-(2,6-dibromophenyl)-2-hydrazinylbenzenesulfonamide (PubChem CID 107600992) has the molecular formula C12H11Br2N3O2S and a molecular weight of 421.11 g/mol. Its IUPAC name is N-(2,6-dibromophenyl)-2-hydrazinylbenzenesulfonamide.
| Compound Name | N-(2,6-dibromophenyl)-2-hydrazinylbenzenesulfonamide |
|---|---|
| PubChem CID | 107600992 |
| Molecular Formula | C12H11Br2N3O2S |
| Molecular Weight | 421.11 g/mol |
| Exact Mass | 418.89 |
| IUPAC Name | N-(2,6-dibromophenyl)-2-hydrazinylbenzenesulfonamide |
| SMILES | NNc1ccccc1S(=O)(=O)Nc1c(Br)cccc1Br |
| InChI | InChI=1S/C12H11Br2N3O2S/c13-8-4-3-5-9(14)12(8)17-20(18,19)11-7-2-1-6-10(11)16-15/h1-7,16-17H,15H2 |
| InChIKey | LKNVTFTVFLQBBH-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.11 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|