C13H9Br2N3O2S — CID 107596269
2-amino-4-cyano-N-(2,6-dibromophenyl)benzenesulfonamide (PubChem CID 107596269) has the molecular formula C13H9Br2N3O2S and a molecular weight of 431.11 g/mol. Its IUPAC name is 2-amino-4-cyano-N-(2,6-dibromophenyl)benzenesulfonamide.
| Compound Name | 2-amino-4-cyano-N-(2,6-dibromophenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 107596269 |
| Molecular Formula | C13H9Br2N3O2S |
| Molecular Weight | 431.11 g/mol |
| Exact Mass | 428.88 |
| IUPAC Name | 2-amino-4-cyano-N-(2,6-dibromophenyl)benzenesulfonamide |
| SMILES | N#Cc1ccc(S(=O)(=O)Nc2c(Br)cccc2Br)c(N)c1 |
| InChI | InChI=1S/C13H9Br2N3O2S/c14-9-2-1-3-10(15)13(9)18-21(19,20)12-5-4-8(7-16)6-11(12)17/h1-6,18H,17H2 |
| InChIKey | KRMDXZHKBIHDNB-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 95.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.11 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|