C10H9N5O2S — CID 64898474
2-amino-4-cyano-N-(1H-pyrazol-4-yl)benzenesulfonamide (PubChem CID 64898474) has the molecular formula C10H9N5O2S and a molecular weight of 263.28 g/mol. Its IUPAC name is 2-amino-4-cyano-N-(1H-pyrazol-4-yl)benzenesulfonamide.
| Compound Name | 2-amino-4-cyano-N-(1H-pyrazol-4-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 64898474 |
| Molecular Formula | C10H9N5O2S |
| Molecular Weight | 263.28 g/mol |
| Exact Mass | 263.05 |
| IUPAC Name | 2-amino-4-cyano-N-(1H-pyrazol-4-yl)benzenesulfonamide |
| SMILES | N#Cc1ccc(S(=O)(=O)Nc2cn[nH]c2)c(N)c1 |
| InChI | InChI=1S/C10H9N5O2S/c11-4-7-1-2-10(9(12)3-7)18(16,17)15-8-5-13-14-6-8/h1-3,5-6,15H,12H2,(H,13,14) |
| InChIKey | ZOLNGZRWTYKEKU-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 124.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.28 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|