C10H10N6O2S — CID 64897423
2-amino-4-cyano-N-(1H-1,2,4-triazol-5-ylmethyl)benzenesulfonamide (PubChem CID 64897423) has the molecular formula C10H10N6O2S and a molecular weight of 278.30 g/mol. Its IUPAC name is 2-amino-4-cyano-N-(1H-1,2,4-triazol-5-ylmethyl)benzenesulfonamide.
| Compound Name | 2-amino-4-cyano-N-(1H-1,2,4-triazol-5-ylmethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 64897423 |
| Molecular Formula | C10H10N6O2S |
| Molecular Weight | 278.30 g/mol |
| Exact Mass | 278.06 |
| IUPAC Name | 2-amino-4-cyano-N-(1H-1,2,4-triazol-5-ylmethyl)benzenesulfonamide |
| SMILES | N#Cc1ccc(S(=O)(=O)NCc2ncn[nH]2)c(N)c1 |
| InChI | InChI=1S/C10H10N6O2S/c11-4-7-1-2-9(8(12)3-7)19(17,18)15-5-10-13-6-14-16-10/h1-3,6,15H,5,12H2,(H,13,14,16) |
| InChIKey | AMLMUEAKKUORGB-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 137.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.30 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|